|
CAS#: 127722-17-2 Product: Methyl (1R,2S)-2-(Hydroxymethyl)-2-Methylcyclopropanecarboxylate No suppilers available for the product. |
| Name | Methyl (1R,2S)-2-(Hydroxymethyl)-2-Methylcyclopropanecarboxylate |
|---|---|
| Synonyms | CYCLOPROP |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 |
| CAS Registry Number | 127722-17-2 |
| SMILES | C[C@@]1(C[C@H]1C(=O)OC)CO |
| InChI | 1S/C7H12O3/c1-7(4-8)3-5(7)6(9)10-2/h5,8H,3-4H2,1-2H3/t5-,7+/m0/s1 |
| InChIKey | IFWWNMZTPUMTPB-CAHLUQPWSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 189.849°C at 760 mmHg (Cal.) |
| Flash point | 71.097°C (Cal.) |
| Refractive index | 1.469 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,2S)-2-(Hydroxymethyl)-2-Methylcyclopropanecarboxylate |