|
CAS#: 127854-46-0 Product: Dimethyl (4S,5S)-1,3,2-Dioxathiolane-4,5-Dicarboxylate 2,2-Dioxide No suppilers available for the product. |
| Name | Dimethyl (4S,5S)-1,3,2-Dioxathiolane-4,5-Dicarboxylate 2,2-Dioxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H8O8S |
| Molecular Weight | 240.19 |
| CAS Registry Number | 127854-46-0 |
| SMILES | O=C(OC)[C@H]1OS(=O)(=O)O[C@@H]1C(=O)OC |
| InChI | 1S/C6H8O8S/c1-11-5(7)3-4(6(8)12-2)14-15(9,10)13-3/h3-4H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | YZPCWPMIVKWDOZ-IMJSIDKUSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.413°C at 760 mmHg (Cal.) |
| Flash point | 176.005°C (Cal.) |
| Refractive index | 1.485 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (4S,5S)-1,3,2-Dioxathiolane-4,5-Dicarboxylate 2,2-Dioxide |