Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-(Sulfamoylamino)Benzoate |
|---|---|
| Synonyms | methyl 2-(sulfamoylamino)benzoate |
| Molecular Structure |  |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 |
| CAS Registry Number | 127903-06-4 |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)N |
| InChI | 1S/C8H10N2O4S/c1-14-8(11)6-4-2-3-5-7(6)10-15(9,12)13/h2-5,10H,1H3,(H2,9,12,13) |
| InChIKey | WSZJADHVJOBSJL-UHFFFAOYSA-N |
| Density | 1.486g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.802°C at 760 mmHg (Cal.) |
| Flash point | 198.617°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-(Sulfamoylamino)Benzoate |