|
CAS#: 127983-95-3 Product: 2-(2-phenylethenyl)-Benzo[h]quinoline ion(1-) No suppilers available for the product. |
| Name | 2-(2-phenylethenyl)-Benzo[h]quinoline ion(1-) |
|---|---|
| Synonyms | Benzo(H)Quinoline, 2-(2-Phenylethenyl)-, Ion(1-); P-Opc; Proxyl-Opc |
| Molecular Structure | ![]() |
| Molecular Formula | C21H14N |
| Molecular Weight | 280.35 |
| CAS Registry Number | 127983-95-3 |
| SMILES | C2=CC1=CC=CC=C1C3=NC(=CC=C23)[C-]=CC4=CC=CC=C4 |
| InChI | 1S/C21H14N/c1-2-6-16(7-3-1)10-14-19-15-13-18-12-11-17-8-4-5-9-20(17)21(18)22-19/h1-13,15H/q-1 |
| InChIKey | MXQUSPRSLDRPMD-UHFFFAOYSA-N |
| Boiling point | 476.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 210.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-phenylethenyl)-Benzo[h]quinoline ion(1-) |