Online Database of Chemicals from Around the World
|
CAS#: 128-84-7 Product: 1,4-Diamino-2,3-Dihydroxyanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1,4-Diamino-2,3-Dihydroxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 1,4-Diamino-2,3-Dihydroxy-Anthracene-9,10-Dione; 1,4-Diamino-2,3-Dihydroxy-9,10-Anthraquinone; 9,10-Anthracenedione, 1,4-Diamino-2,3-Dihydroxy- |
| Molecular Structure |  |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 128-84-7 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C(=C(C(=C3N)O)O)N |
| InChI | 1S/C14H10N2O4/c15-9-7-8(10(16)14(20)13(9)19)12(18)6-4-2-1-3-5(6)11(7)17/h1-4,19-20H,15-16H2 |
| InChIKey | OFIYINUGSZSGAW-UHFFFAOYSA-N |
| Density | 1.684g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.564°C at 760 mmHg (Cal.) |
| Flash point | 264.999°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Diamino-2,3-Dihydroxyanthracene-9,10-Dione |