|
CAS#: 128213-58-1 Product: Osmium Tetroxide N,N,N',N'-Tetramethylethylenediamine No suppilers available for the product. |
| Name | Osmium Tetroxide N,N,N',N'-Tetramethylethylenediamine |
|---|---|
| Synonyms | 2-Dimethylaminoethyl-Dimethyl-Amine; Tetraketoosmium; Os Tmen; Osmium Tetroxide N,N,N',N'-Tetramethylethylenediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16N2O4Os |
| Molecular Weight | 370.40 |
| CAS Registry Number | 128213-58-1 |
| SMILES | [Os](=O)(=O)(=O)=O.C(N(C)C)CN(C)C |
| InChI | 1S/C6H16N2.4O.Os/c1-7(2)5-6-8(3)4;;;;;/h5-6H2,1-4H3;;;;; |
| InChIKey | BOXUJTXQLSUQQK-UHFFFAOYSA-N |
| Boiling point | 121°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 10°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Osmium Tetroxide N,N,N',N'-Tetramethylethylenediamine |