| Name | 6-(1,3-Dioxo-1,3-Dihydro-2H-Isoindol-2-Yl)Hexaneperoxoic Acid |
|---|---|
| Synonyms | EURECO HC; PAP |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.27 |
| CAS Registry Number | 128275-31-0 |
| SMILES | O=C2c1ccccc1C(=O)N2CCCCCC(=O)OO |
| InChI | 1S/C14H15NO5/c16-12(20-19)8-2-1-5-9-15-13(17)10-6-3-4-7-11(10)14(15)18/h3-4,6-7,19H,1-2,5,8-9H2 |
| InChIKey | UZJGVXSQDRSSHU-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.829°C at 760 mmHg (Cal.) |
| Flash point | 230.082°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| (1) | Marco Giardiello, Tom O. McDonald, Jet-Sing Lee, Aled D. Roberts, Andrew Owen and Steve P. Rannard. Reactions of hydrophobic organic nanoparticle mixtures in water: nanoparticle-on-nanoparticle oxidative dye bleaching, Green Chem., 2013, 15, 1590. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-(1,3-Dioxo-1,3-Dihydro-2H-Isoindol-2-Yl)Hexaneperoxoic Acid |