|
CAS#: 128941-62-8 Product: 6,7-Cyclopentano-5-Methylchrysene No suppilers available for the product. |
| Name | 6,7-Cyclopentano-5-Methylchrysene |
|---|---|
| Synonyms | 6,7-Cyp-5-Mec; Cyclopenta(Hi)Chrysene, 4,5-Dihydro-6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 |
| CAS Registry Number | 128941-62-8 |
| SMILES | C1=CC=CC2=C1C=CC3=C2C(=C5C4=C3C=CC=C4CC5)C |
| InChI | 1S/C21H16/c1-13-16-11-10-15-6-4-8-18(21(15)16)19-12-9-14-5-2-3-7-17(14)20(13)19/h2-9,12H,10-11H2,1H3 |
| InChIKey | FLDPAWNSJWKHHE-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.413°C at 760 mmHg (Cal.) |
| Flash point | 253.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Cyclopentano-5-Methylchrysene |