|
CAS#: 129145-65-9 Product: Methyl (2E,3Z,5E)-2-(Methoxymethylidene)-6-(3-Methoxyphenyl)-3-Methylhexa-3,5-Dienoate No suppilers available for the product. |
| Name | Methyl (2E,3Z,5E)-2-(Methoxymethylidene)-6-(3-Methoxyphenyl)-3-Methylhexa-3,5-Dienoate |
|---|---|
| Synonyms | Methyl (2E,3Z,5E)-2-(Methoxymethylene)-6-(3-Methoxyphenyl)-3-Methyl-Hexa-3,5-Dienoate; (2E,3Z,5E)-2-(Methoxymethylene)-6-(3-Methoxyphenyl)-3-Methylhexa-3,5-Dienoic Acid Methyl Ester; (2E,3Z,5E)-2-(Methoxymethylene)-6-(3-Methoxyphenyl)-3-Methyl-Hexa-3,5-Dienoic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 |
| CAS Registry Number | 129145-65-9 |
| SMILES | C1=C(OC)C=CC=C1/C=C/C=C(\C(C(OC)=O)=C/OC)C |
| InChI | 1S/C17H20O4/c1-13(16(12-19-2)17(18)21-4)7-5-8-14-9-6-10-15(11-14)20-3/h5-12H,1-4H3/b8-5+,13-7-,16-12+ |
| InChIKey | MTTZSOSUZLNSSO-PLJMREBYSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.855°C at 760 mmHg (Cal.) |
| Flash point | 197.535°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2E,3Z,5E)-2-(Methoxymethylidene)-6-(3-Methoxyphenyl)-3-Methylhexa-3,5-Dienoate |