|
CAS#: 129200-07-3 Product: (5alpha,6beta)-6-(Acetylthio)-17-(Cyclopropylmethyl)-7,8-Didehydro-4,5-Epoxymorphinan-3-Ol Acetate (Ester) No suppilers available for the product. |
| Name | (5alpha,6beta)-6-(Acetylthio)-17-(Cyclopropylmethyl)-7,8-Didehydro-4,5-Epoxymorphinan-3-Ol Acetate (Ester) |
|---|---|
| Synonyms | Kt 90; Kt-90; Morphinan-3-Ol, 6-(Acetylthio)-17-(Cyclopropylmethyl)-7,8-Didehydro-4,5-Epoxy-, Acetate (Ester), (5Alpha,6Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.54 |
| CAS Registry Number | 129200-07-3 |
| SMILES | [C@]135[C@H]6OC2=C1C(=CC=C2OC(=O)C)C[C@@H](N(CC3)CC4CC4)[C@@H]5C=C[C@H]6SC(=O)C |
| InChI | 1S/C24H27NO4S/c1-13(26)28-19-7-5-16-11-18-17-6-8-20(30-14(2)27)23-24(17,21(16)22(19)29-23)9-10-25(18)12-15-3-4-15/h5-8,15,17-18,20,23H,3-4,9-12H2,1-2H3/t17-,18+,20+,23-,24-/m0/s1 |
| InChIKey | CGBBASLLYGTYNG-KEESSRIGSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.039°C at 760 mmHg (Cal.) |
| Flash point | 297.34°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5alpha,6beta)-6-(Acetylthio)-17-(Cyclopropylmethyl)-7,8-Didehydro-4,5-Epoxymorphinan-3-Ol Acetate (Ester) |