|
CAS#: 129248-73-3 Product: 2-[(2-Phenylphenyl)Amino]Acetohydrazide No suppilers available for the product. |
| Name | 2-[(2-Phenylphenyl)Amino]Acetohydrazide |
|---|---|
| Synonyms | 2-[(2-Phenylphenyl)Amino]Ethanehydrazide; N-(Biphenyl)Glycylhydrazide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 |
| CAS Registry Number | 129248-73-3 |
| SMILES | C1=C(NCC(=O)NN)C(=CC=C1)C2=CC=CC=C2 |
| InChI | 1S/C14H15N3O/c15-17-14(18)10-16-13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9,16H,10,15H2,(H,17,18) |
| InChIKey | RYXCXBYRLLSOAH-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.467°C at 760 mmHg (Cal.) |
| Flash point | 275.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Phenylphenyl)Amino]Acetohydrazide |