|
CAS#: 129462-42-6 Product: 2-[(4-Amino-2-Nitrophenyl)Methylamino]Acetohydrazide No suppilers available for the product. |
| Name | 2-[(4-Amino-2-Nitrophenyl)Methylamino]Acetohydrazide |
|---|---|
| Synonyms | 2-[(4-Amino-2-Nitro-Phenyl)Methylamino]Acetohydrazide; 2-[(4-Amino-2-Nitro-Benzyl)Amino]Acetohydrazide; 2-[(4-Amino-2-Nitro-Phenyl)Methylamino]Ethanehydrazide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 |
| CAS Registry Number | 129462-42-6 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1N)CNCC(=O)NN |
| InChI | 1S/C9H13N5O3/c10-7-2-1-6(8(3-7)14(16)17)4-12-5-9(15)13-11/h1-3,12H,4-5,10-11H2,(H,13,15) |
| InChIKey | MAPGYXGKILYNNC-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.429°C at 760 mmHg (Cal.) |
| Flash point | 279.432°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Amino-2-Nitrophenyl)Methylamino]Acetohydrazide |