|
CAS#: 129679-50-1 Product: Dihydro-1,4-dimethyl-1,4-Ethano-1H,3H-furo(3,4-c)furan-3,6(4H)-dione No suppilers available for the product. |
| Name | Dihydro-1,4-dimethyl-1,4-Ethano-1H,3H-furo(3,4-c)furan-3,6(4H)-dione |
|---|---|
| Synonyms | 1,4-Ethano-1H,3H-Furo(3,4-C)Furan-3,6(4H)-Dione, Dihydro-1,4-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 129679-50-1 |
| SMILES | CC23C1C(C(OC1=O)(CC2)C)C(O3)=O |
| InChI | 1S/C10H12O4/c1-9-3-4-10(2)6(8(12)13-9)5(9)7(11)14-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | VGVJHBAJIFZPJX-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.862°C at 760 mmHg (Cal.) |
| Flash point | 213.886°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydro-1,4-dimethyl-1,4-Ethano-1H,3H-furo(3,4-c)furan-3,6(4H)-dione |