|
CAS#: 129959-03-1 Product: Ethyl 21,21,21-Trifluoroapovincaminate No suppilers available for the product. |
| Name | Ethyl 21,21,21-Trifluoroapovincaminate |
|---|---|
| Synonyms | 21,21,21-Tfaee; 21,21,21-Trifluoroapovincaminic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 |
| CAS Registry Number | 129959-03-1 |
| SMILES | [C@H]12N3CCC4=C1[N](C(=C[C@]2(CCC3)CC(F)(F)F)C(OCC)=O)C5=CC=CC=C45 |
| InChI | 1S/C22H23F3N2O2/c1-2-29-20(28)17-12-21(13-22(23,24)25)9-5-10-26-11-8-15-14-6-3-4-7-16(14)27(17)18(15)19(21)26/h3-4,6-7,12,19H,2,5,8-11,13H2,1H3/t19-,21+/m0/s1 |
| InChIKey | NALBTKVBJYORJH-PZJWPPBQSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.925°C at 760 mmHg (Cal.) |
| Flash point | 205.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 21,21,21-Trifluoroapovincaminate |