|
CAS#: 13004-58-5 Product: Etipirol No suppilers available for the product. |
| Name | Etipirol |
|---|---|
| Synonyms | 1-Ethyl-N,N'-Dimethyl-Pyrazole-3,4-Dicarboxamide; 1-Ethyl-N,N'-Dimethyl-1H-Pyrazole-3,4-Dicarboxamide; 5-25-05-00334 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 |
| CAS Registry Number | 13004-58-5 |
| SMILES | C1=C(C(=N[N]1CC)C(NC)=O)C(NC)=O |
| InChI | 1S/C9H14N4O2/c1-4-13-5-6(8(14)10-2)7(12-13)9(15)11-3/h5H,4H2,1-3H3,(H,10,14)(H,11,15) |
| InChIKey | CLJBPOOJGPRGPF-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.313°C at 760 mmHg (Cal.) |
| Flash point | 255.171°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Etipirol |