|
CAS#: 13010-10-1 Product: N'-Nitro-N-Pentyl-N-Nitrosoguanidine No suppilers available for the product. |
| Name | N'-Nitro-N-Pentyl-N-Nitrosoguanidine |
|---|---|
| Synonyms | [[Amino-(Nitroso-Pentylamino)Methylidene]Amino]-Hydroxy-Oxoazanium; 2-Nitro-1-Nitroso-1-Pentylguanidine; 2-Nitro-1-Nitroso-1-Pentyl-Guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13N5O3 |
| Molecular Weight | 203.20 |
| CAS Registry Number | 13010-10-1 |
| EINECS | 235-858-7 |
| SMILES | C(CCC)CN(N=O)C(/N)=N/[N+]([O-])=O |
| InChI | 1S/C6H13N5O3/c1-2-3-4-5-10(9-12)6(7)8-11(13)14/h2-5H2,1H3,(H2,7,8) |
| InChIKey | OKMNBMCHWAWZBL-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.723°C at 760 mmHg (Cal.) |
| Flash point | 148.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-Nitro-N-Pentyl-N-Nitrosoguanidine |