|
CAS#: 13012-98-1 Product: [Bis(Dimethylamino)Methyleneamino]Bis(Dimethylamino)Phosphine Oxide No suppilers available for the product. |
| Name | [Bis(Dimethylamino)Methyleneamino]Bis(Dimethylamino)Phosphine Oxide |
|---|---|
| Synonyms | 2-Bis(Dimethylamino)Phosphoryl-1,1,3,3-Tetramethyl-Guanidine; P-(Bis(Dimethylamino)Methyleneamino)-N,N,N',N'-Tetramethylphosphonic Diamide; Brn 1912493 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H24N5OP |
| Molecular Weight | 249.30 |
| CAS Registry Number | 13012-98-1 |
| SMILES | CN([P](N=C(N(C)C)N(C)C)(N(C)C)=O)C |
| InChI | 1S/C9H24N5OP/c1-11(2)9(12(3)4)10-16(15,13(5)6)14(7)8/h1-8H3 |
| InChIKey | HRLGWPJKGSKFTP-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.476°C at 760 mmHg (Cal.) |
| Flash point | 133.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [Bis(Dimethylamino)Methyleneamino]Bis(Dimethylamino)Phosphine Oxide |