|
CAS#: 13022-41-8 Product: Tyrosyltyrosine Methyl Ester No suppilers available for the product. |
| Name | Tyrosyltyrosine Methyl Ester |
|---|---|
| Synonyms | (2S)-2-[[(2S)-2-Amino-3-(4-Hydroxyphenyl)-1-Oxopropyl]Amino]-3-(4-Hydroxyphenyl)Propanoic Acid Methyl Ester; (2S)-2-[[(2S)-2-Amino-3-(4-Hydroxyphenyl)Propanoyl]Amino]-3-(4-Hydroxyphenyl)Propionic Acid Methyl Ester; L-Tyrosine, N-L-Tyrosyl-, Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 |
| CAS Registry Number | 13022-41-8 |
| SMILES | [C@H](NC(=O)[C@@H](N)CC1=CC=C(O)C=C1)(CC2=CC=C(O)C=C2)C(OC)=O |
| InChI | 1S/C19H22N2O5/c1-26-19(25)17(11-13-4-8-15(23)9-5-13)21-18(24)16(20)10-12-2-6-14(22)7-3-12/h2-9,16-17,22-23H,10-11,20H2,1H3,(H,21,24)/t16-,17-/m0/s1 |
| InChIKey | WMDIJJVEUHFXIU-IRXDYDNUSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 642.285°C at 760 mmHg (Cal.) |
| Flash point | 342.242°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tyrosyltyrosine Methyl Ester |