|
CAS#: 13037-79-1 Product: 2-Tert-Butyl-3-Methylphenol No suppilers available for the product. |
| Name | 2-Tert-Butyl-3-Methylphenol |
|---|---|
| Synonyms | 2-Tert-Butyl-3-Methyl-Phenol; 2-Tert-Butyl-M-Cresol; M-Cresol, 2-Tert-Butyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 |
| CAS Registry Number | 13037-79-1 |
| SMILES | C1=CC(=C(C(=C1)O)C(C)(C)C)C |
| InChI | 1S/C11H16O/c1-8-6-5-7-9(12)10(8)11(2,3)4/h5-7,12H,1-4H3 |
| InChIKey | SDJUKATYFRSDAS-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.897°C at 760 mmHg (Cal.) |
| Flash point | 104.637°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Tert-Butyl-3-Methylphenol |