|
CAS#: 13039-82-2 Product: 2-Amino-6-[(1S,2S)-1,2-Dihydroxypropyl]-4(1H)-Pteridinone No suppilers available for the product. |
| Name | 2-Amino-6-[(1S,2S)-1,2-Dihydroxypropyl]-4(1H)-Pteridinone |
|---|---|
| Synonyms | 2-amino-6-[(1S,2S)-1,2-dihydroxypropyl]pteridin-4(1H)-one; 6-(L-threo-1,2-dihydroxypropyl)-pterin |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 |
| CAS Registry Number | 13039-82-2 |
| SMILES | C[C@H](O)[C@@H](O)c1cnc2NC(/N)=N\C(=O)c2n1 |
| InChI | 1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17)/t3-,6+/m0/s1 |
| InChIKey | LHQIJBMDNUYRAM-BBIVZNJYSA-N |
| Density | 1.866g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.162°C at 760 mmHg (Cal.) |
| Flash point | 310.719°C (Cal.) |
| Refractive index | 1.821 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-[(1S,2S)-1,2-Dihydroxypropyl]-4(1H)-Pteridinone |