|
CAS#: 13049-35-9 Product: 2,2'-Diethyl-1,1'-biphenyl No suppilers available for the product. |
| Name | 2,2'-Diethyl-1,1'-biphenyl |
|---|---|
| Synonyms | 2,2'-Diethyl-1,1'-Biphenyl; Biphenyl, 2,2'-Diethyl-; 1,1'-Biphenyl, 2,2'-Diethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 13049-35-9 |
| SMILES | C1=CC(=C(C=C1)C2=C(C=CC=C2)CC)CC |
| InChI | 1S/C16H18/c1-3-13-9-5-7-11-15(13)16-12-8-6-10-14(16)4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | VYVNYOJZPQVWHK-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.955°C at 760 mmHg (Cal.) |
| Flash point | 165.881°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Diethyl-1,1'-biphenyl |