|
CAS#: 130521-05-0 Product: 2-Amino-3,3-Difluoropentanedioic Acid No suppilers available for the product. |
| Name | 2-Amino-3,3-Difluoropentanedioic Acid |
|---|---|
| Synonyms | 2-Amino-3,3-Difluoro-Pentanedioic Acid; 2-Amino-3,3-Difluoro-Glutaric Acid; Dl-Beta,Beta-Difluoroglutamic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7F2NO4 |
| Molecular Weight | 183.11 |
| CAS Registry Number | 130521-05-0 |
| SMILES | C(C(F)(F)C(N)C(O)=O)C(O)=O |
| InChI | 1S/C5H7F2NO4/c6-5(7,1-2(9)10)3(8)4(11)12/h3H,1,8H2,(H,9,10)(H,11,12) |
| InChIKey | HJJKSOSDUQANSX-UHFFFAOYSA-N |
| Density | 1.588g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.589°C at 760 mmHg (Cal.) |
| Flash point | 179.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3,3-Difluoropentanedioic Acid |