|
CAS#: 130595-24-3 Product: Phomactin A No suppilers available for the product. |
| Name | Phomactin A |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45 |
| CAS Registry Number | 130595-24-3 |
| SMILES | [C@@]14([C@@H](C[C@H]2O[C@]([C@H](O)[C@]3(OCC1=C23)O)(CC/C=C(CC4)/C)C)C)C |
| InChI | 1S/C20H30O4/c1-12-6-5-8-19(4)17(21)20(22)16-14(11-23-20)18(3,9-7-12)13(2)10-15(16)24-19/h6,13,15,17,21-22H,5,7-11H2,1-4H3/b12-6-/t13-,15-,17+,18+,19+,20+/m1/s1 |
| InChIKey | ABEFPCRGBOFMDC-OSERUOPNSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.108°C at 760 mmHg (Cal.) |
| Flash point | 242.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phomactin A |