| AEchem Scientific Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (630) 364-5106 | |||
![]() |
info@aechemsc.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | alpha-D-Lyxopyranose |
|---|---|
| Synonyms | (2S,3S,4S,5R)-tetrahydro-2H-pyran-2,3,4,5-tetraol |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 130606-21-2 |
| SMILES | C1[C@H]([C@@H]([C@@H]([C@H](O1)O)O)O)O |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4+,5+/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-STGXQOJASA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 155.3±27.9°C (Cal.) |
| Refractive index | 1.646 (Cal.) |
| (1) | Stefan Taubert, Henrik Konschin and Dage Sundholm. Computational studies of C NMR chemical shifts of saccharides, Phys. Chem. Chem. Phys., 2005, 7, 2561. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for alpha-D-Lyxopyranose |