|
CAS#: 13074-85-6 Product: Citric Acid Samarium(III) Salt No suppilers available for the product. |
| Name | Citric Acid Samarium(III) Salt |
|---|---|
| Synonyms | Samarium(+3) Cation Citrate; Citric Acid, Samarium Salt; Samarium Citrate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5O7Sm |
| Molecular Weight | 339.50 |
| CAS Registry Number | 13074-85-6 |
| SMILES | [Sm+3].C(C(O)(C([O-])=O)CC([O-])=O)C([O-])=O |
| InChI | 1S/C6H8O7.Sm/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+3/p-3 |
| InChIKey | ZLPZMGRIYAWMNV-UHFFFAOYSA-K |
| Boiling point | 309.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Citric Acid Samarium(III) Salt |