|
CAS#: 131061-20-6 Product: N,N-Bis(2-Phenyl-2-Propanyl)Formamide No suppilers available for the product. |
| Name | N,N-Bis(2-Phenyl-2-Propanyl)Formamide |
|---|---|
| Synonyms | di-(1-phenylisopropyl)formamide |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.39 |
| CAS Registry Number | 131061-20-6 |
| SMILES | CC(C)(c1ccccc1)N(C=O)C(C)(C)c2ccccc2 |
| InChI | 1S/C19H23NO/c1-18(2,16-11-7-5-8-12-16)20(15-21)19(3,4)17-13-9-6-10-14-17/h5-15H,1-4H3 |
| InChIKey | ABVNQMIMQIGULP-UHFFFAOYSA-N |
| Density | 1.035g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.086°C at 760 mmHg (Cal.) |
| Flash point | 165.66°C (Cal.) |
| Refractive index | 1.549 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2-Phenyl-2-Propanyl)Formamide |