|
CAS#: 131131-33-4 Product: 3,3,3-Trifluoro-2-Methyl-N-[4-Nitro-3-(Trifluoromethyl)Phenyl]Propanamide No suppilers available for the product. |
| Name | 3,3,3-Trifluoro-2-Methyl-N-[4-Nitro-3-(Trifluoromethyl)Phenyl]Propanamide |
|---|---|
| Synonyms | 3,3,3-Tri |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8F6N2O3 |
| Molecular Weight | 330.18 |
| CAS Registry Number | 131131-33-4 |
| SMILES | CC(C(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F)C(F)(F)F |
| InChI | 1S/C11H8F6N2O3/c1-5(10(12,13)14)9(20)18-6-2-3-8(19(21)22)7(4-6)11(15,16)17/h2-5H,1H3,(H,18,20) |
| InChIKey | UFAVNMXPBBUQAE-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 185.2±27.9°C (Cal.) |
| Refractive index | 1.479 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,3-Trifluoro-2-Methyl-N-[4-Nitro-3-(Trifluoromethyl)Phenyl]Propanamide |