|
CAS#: 13121-64-7 Product: Tagatosazine No suppilers available for the product. |
| Name | Tagatosazine |
|---|---|
| Synonyms | (1R,2R,3R)-1-[5-[(1R,2R,3R)-1,2,3,4-Tetrahydroxybutyl]-2-Pyrazinyl]Butane-1,2,3,4-Tetrol; 1,2,3,4-Butanetetrol, 1,1'-(2,5-Pyrazinediyl)Bis-, (1R-(1R*,1'R*,2R*,2'R*,3S*,3'S*))-; 2,5-Bis-(D-Lyxotetrahydroxybutyl)Pyrazine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.30 |
| CAS Registry Number | 13121-64-7 |
| SMILES | [C@@H](C1=NC=C(N=C1)[C@H]([C@H]([C@@H](CO)O)O)O)([C@H]([C@@H](CO)O)O)O |
| InChI | 1S/C12H20N2O8/c15-3-7(17)11(21)9(19)5-1-13-6(2-14-5)10(20)12(22)8(18)4-16/h1-2,7-12,15-22H,3-4H2/t7-,8-,9-,10-,11+,12+/m1/s1 |
| InChIKey | NPWQIVOYGNUVEB-JKCCIXDMSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 764.85°C at 760 mmHg (Cal.) |
| Flash point | 416.366°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tagatosazine |