Online Database of Chemicals from Around the World
|
CAS#: 131373-01-8 Product: 5,6-Dihydrobenzo[f]Isoquinolin-1-Yl(Trimethyl)Silane No suppilers available for the product. |
| Name | 5,6-Dihydrobenzo[f]Isoquinolin-1-Yl(Trimethyl)Silane |
|---|---|
| Synonyms | 1-Trimethylsilanyl-5,6-dihydro-benzo[f]isoquinoline |
| Molecular Structure | ![CAS#: 131373-01-8, 5,6-Dihydrobenzo[f]Isoquinolin-1-Yl(Trimethyl)Silane](/moreStructures/131373-01-8.gif) |
| Molecular Formula | C16H19NSi |
| Molecular Weight | 253.41 |
| CAS Registry Number | 131373-01-8 |
| SMILES | C[Si](C)(C)c1cncc2c1-c3ccccc3CC2 |
| InChI | 1S/C16H19NSi/c1-18(2,3)15-11-17-10-13-9-8-12-6-4-5-7-14(12)16(13)15/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | XRCZXMSHMJVXRH-UHFFFAOYSA-N |
| Density | 1.053g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.546°C at 760 mmHg (Cal.) |
| Flash point | 172.457°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dihydrobenzo[f]Isoquinolin-1-Yl(Trimethyl)Silane |