|
CAS#: 131426-59-0 Product: N,N-Dimethylpradimicin FA-2 No suppilers available for the product. |
| Name | N,N-Dimethylpradimicin FA-2 |
|---|---|
| Synonyms | Aids008514; Bmy-28864; N,N-Dimethylpradimicin Fa-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C41H46N2O19 |
| Molecular Weight | 870.82 |
| CAS Registry Number | 131426-59-0 |
| SMILES | [C@H]4([C@H](C3=CC1=C(C(C2=C(C1=O)C(=CC(=C2)OC)O)=O)C(=C3C5=C4C=C(C(=C5O)C(NC(C(=O)O)CO)=O)C)O)O)OC7C(C(OC6C(C(O)C(CO6)O)O)C(C(O7)C)N(C)C)O |
| InChI | 1S/C41H46N2O19/c1-12-6-18-25(32(51)22(12)38(55)42-19(10-44)39(56)57)24-16(9-17-26(33(24)52)29(48)15-7-14(58-5)8-20(45)23(15)28(17)47)30(49)36(18)61-41-35(54)37(27(43(3)4)13(2)60-41)62-40-34(53)31(50)21(46)11-59-40/h6-9,13,19,21,27,30-31,34-37,40-41,44-46,49-54H,10-11H2,1-5H3,(H,42,55)(H,56,57)/t13?,19?,21?,27?,30-,31?,34?,35?,36-,37?,40?,41?/m0/s1 |
| InChIKey | UZMZCRAPEXDPLT-WECHQNJZSA-N |
| Density | 1.707g/cm3 (Cal.) |
|---|---|
| Boiling point | 1147.566°C at 760 mmHg (Cal.) |
| Flash point | 647.824°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethylpradimicin FA-2 |