| Name | 2-Naphthyl Sulfate |
|---|---|
| Synonyms | Potassium 2-Naphthyl Sulfate; Potassium Naphthalene-2-Sulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7KO4S |
| Molecular Weight | 262.32 |
| CAS Registry Number | 13146-59-3 |
| EINECS | 244-375-0 |
| SMILES | C1=C2C(=CC(=C1)O[S](=O)(=O)[O-])C=CC=C2.[K+] |
| InChI | 1S/C10H8O4S.K/c11-15(12,13)14-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,(H,11,12,13);/q;+1/p-1 |
| InChIKey | SKROFUUKJBLLKJ-UHFFFAOYSA-M |
| Melting point | 300°C (Expl.) |
|---|---|
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Naphthyl Sulfate |