Online Database of Chemicals from Around the World
|
CAS#: 131575-04-7 Product: 14-Ethoxymetopon No suppilers available for the product. |
| Name | 14-Ethoxymetopon |
|---|---|
| Synonyms | Morphinan-6-One, 4,5-Epoxy-14-Ethoxy-3-Hydroxy-5,17-Dimethyl-, (5Alpha)- |
| Molecular Structure |  |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 |
| CAS Registry Number | 131575-04-7 |
| SMILES | [C@]24(C35C1=C(C=CC(=C1O2)O)C[C@H](C3(CCC4=O)OCC)N(CC5)C)C |
| InChI | 1S/C20H25NO4/c1-4-24-20-8-7-15(23)18(2)19(20)9-10-21(3)14(20)11-12-5-6-13(22)17(25-18)16(12)19/h5-6,14,22H,4,7-11H2,1-3H3/t14-,18-,19?,20?/m1/s1 |
| InChIKey | LDTUYTORBPKTNO-HPJZBDCMSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.987°C at 760 mmHg (Cal.) |
| Flash point | 250.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 14-Ethoxymetopon |