Online Database of Chemicals from Around the World
| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
 |
+31 (15) 251-8111 | |||
 |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 3-(alpha,alpha-Dimethylallyl)Psoralen |
|---|---|
| Synonyms | 6-(1,1-Dimethylprop-2-Enyl)Pyrano[5,6-F]Benzofuran-7-One; 6-(1,1-Dimethylprop-2-Enyl)-7-Pyrano[5,6-F]Benzofuranone; Megxp0_000992 |
| Molecular Structure |  |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 13164-03-9 |
| SMILES | C1=C3C(=CC2=C1C=C(C(C)(C)C=C)C(O2)=O)OC=C3 |
| InChI | 1S/C16H14O3/c1-4-16(2,3)12-8-11-7-10-5-6-18-13(10)9-14(11)19-15(12)17/h4-9H,1H2,2-3H3 |
| InChIKey | FYCCCUNGXGKNJV-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.511°C at 760 mmHg (Cal.) |
| Flash point | 189.974°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(alpha,alpha-Dimethylallyl)Psoralen |