|
CAS#: 131844-70-7 Product: 1,1':3',1''-Terphenyl-4',6'-Diol No suppilers available for the product. |
| Name | 1,1':3',1''-Terphenyl-4',6'-Diol |
|---|---|
| Synonyms | [1,1:3,1-Terphenyl]-4,6-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.30 |
| CAS Registry Number | 131844-70-7 |
| SMILES | c1ccc(cc1)c2cc(c(cc2O)O)c3ccccc3 |
| InChI | 1S/C18H14O2/c19-17-12-18(20)16(14-9-5-2-6-10-14)11-15(17)13-7-3-1-4-8-13/h1-12,19-20H |
| InChIKey | JTZMHBIDDPPUKL-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.895°C at 760 mmHg (Cal.) |
| Flash point | 223.54°C (Cal.) |
| Refractive index | 1.651 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1':3',1''-Terphenyl-4',6'-Diol |