|
CAS#: 131903-56-5 Product: (2R)-1-Phenyl-N-(3-Phenylpropyl)Propan-2-Amine Hydrochloride No suppilers available for the product. |
| Name | (2R)-1-Phenyl-N-(3-Phenylpropyl)Propan-2-Amine Hydrochloride |
|---|---|
| Synonyms | [(1R)-1-Methyl-2-Phenyl-Ethyl]-(3-Phenylpropyl)Amine Hydrochloride; Ppap; R(-)-N-(3-Phenyl-N-Propyl)-1-Phenyl-2-Aminopropane Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24ClN |
| Molecular Weight | 289.85 |
| CAS Registry Number | 131903-56-5 |
| SMILES | [C@H](NCCCC1=CC=CC=C1)(CC2=CC=CC=C2)C.[H+].[Cl-] |
| InChI | 1S/C18H23N.ClH/c1-16(15-18-11-6-3-7-12-18)19-14-8-13-17-9-4-2-5-10-17;/h2-7,9-12,16,19H,8,13-15H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | NOOYIVIUEHDMSF-PKLMIRHRSA-N |
| Boiling point | 381.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 176.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-1-Phenyl-N-(3-Phenylpropyl)Propan-2-Amine Hydrochloride |