|
CAS#: 131998-54-4 Product: Westiellamide No suppilers available for the product. |
| Name | Westiellamide |
|---|---|
| Synonyms | Trisoxazoline; 6,13,20-Trioxa-3,10,17,22,23,24-Hexaazatetracyclo(17.2.1.1(5,8).1(12,15))Tetracosa-5(24),12(23),19(22)-Triene-2,9,16-Trione, 7,14,21-Trimethyl-4,11,18-Tris(1-Methylethyl)-, (1S-(1R*,4R*,7S*,8R*,11R*,14S*,15R*,18R*,21S*))-; C15739 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H42N6O6 |
| Molecular Weight | 546.67 |
| CAS Registry Number | 131998-54-4 |
| SMILES | [C@H]12N=C(O[C@@H]1C)[C@@H](NC([C@H]4N=C([C@H](C(C)C)NC([C@H]3N=C([C@@H](NC2=O)C(C)C)O[C@@H]3C)=O)O[C@@H]4C)=O)C(C)C |
| InChI | 1S/C27H42N6O6/c1-10(2)16-25-31-20(13(7)37-25)23(35)29-18(12(5)6)27-33-21(15(9)39-27)24(36)30-17(11(3)4)26-32-19(14(8)38-26)22(34)28-16/h10-21H,1-9H3,(H,28,34)(H,29,35)(H,30,36)/t13-,14-,15-,16+,17+,18+,19+,20+,21+/m1/s1 |
| InChIKey | MIDTUAMKJJDHAR-YAWPOEEYSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 782.334°C at 760 mmHg (Cal.) |
| Flash point | 426.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Westiellamide |