|
CAS#: 132-45-6 Product: 2-Diethylaminoethyl 2-Phenylpentanoate Hydrochloride No suppilers available for the product. |
| Name | 2-Diethylaminoethyl 2-Phenylpentanoate Hydrochloride |
|---|---|
| Synonyms | 2-Phenylpentanoic Acid 2-Diethylaminoethyl Ester Hydrochloride; 2-Phenylvaleric Acid 2-Diethylaminoethyl Ester Hydrochloride; 177 R.P. |
| Molecular Structure | ![]() |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 |
| CAS Registry Number | 132-45-6 |
| SMILES | [H+].C1=C(C(CCC)C(OCCN(CC)CC)=O)C=CC=C1.[Cl-] |
| InChI | 1S/C17H27NO2.ClH/c1-4-10-16(15-11-8-7-9-12-15)17(19)20-14-13-18(5-2)6-3;/h7-9,11-12,16H,4-6,10,13-14H2,1-3H3;1H |
| InChIKey | IATOMHNNMDOQEO-UHFFFAOYSA-N |
| Boiling point | 363.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 111.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Diethylaminoethyl 2-Phenylpentanoate Hydrochloride |