| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Amadis Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (571) 8992-5085 | |||
![]() |
sales@amadischem.com | |||
![]() |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| Name | Potassium Aminobenzoate |
|---|---|
| Synonyms | Potassium Anthranilate; Potassium Aminobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6KNO2 |
| Molecular Weight | 175.23 |
| CAS Registry Number | 1321-13-7 |
| EINECS | 215-312-4 |
| SMILES | C1=CC=CC(=C1C([O-])=O)N.[K+] |
| InChI | 1S/C7H7NO2.K/c8-6-4-2-1-3-5(6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1 |
| InChIKey | VLSHYHUKASKGPF-UHFFFAOYSA-M |
| Boiling point | 311.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 142.4°C (Cal.) |
| (1) | Frank Wiesbrock and Hubert Schmidbaur. The structural chemistry of lithium, sodium and potassium anthranilate hydrates, Dalton Trans., 2002, 0, 4703. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Potassium Aminobenzoate |