|
CAS#: 13214-58-9 Product: 1-Fluoro-1,1-Dinitroethane No suppilers available for the product. |
| Name | 1-Fluoro-1,1-Dinitroethane |
|---|---|
| Synonyms | 1-Fluoro-1,1-Dinitro-Ethane |
| Molecular Structure | ![]() |
| Molecular Formula | C2H3FN2O4 |
| Molecular Weight | 138.06 |
| CAS Registry Number | 13214-58-9 |
| SMILES | CC([N+](=O)[O-])([N+](=O)[O-])F |
| InChI | 1S/C2H3FN2O4/c1-2(3,4(6)7)5(8)9/h1H3 |
| InChIKey | INUKSLQNFYBSOB-UHFFFAOYSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 133.61°C at 760 mmHg (Cal.) |
| Flash point | 34.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Fluoro-1,1-Dinitroethane |