|
CAS#: 132160-37-3 Product: Glabredelphinine No suppilers available for the product. |
| Name | Glabredelphinine |
|---|---|
| Synonyms | 2(3)-Dehydro-6-demethyl-18-demethoxydelcosine; Aconitane |
| Molecular Structure | ![]() |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.50 |
| CAS Registry Number | 132160-37-3 |
| SMILES | O(C)[C@H]1C[C@@]5(O)[C@H]2[C@@H](O)[C@H]1C[C@@H]2C43C6N(CC)C[C@](\C=C/[C@@H]3O)([C@H]4[C@H](O)C56O)C |
| InChI | 1S/C22H33NO6/c1-4-23-9-19(2)6-5-13(24)21-11-7-10-12(29-3)8-20(27,14(11)15(10)25)22(28,18(21)23)17(26)16(19)21/h5-6,10-18,24-28H,4,7-9H2,1-3H3/t10-,11-,12-,13-,14+,15-,16+,17-,18?,19-,20+,21?,22?/m0/s1 |
| InChIKey | DTGBDZOZFYXFTM-OTLWYDEWSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 603.092°C at 760 mmHg (Cal.) |
| Flash point | 318.539°C (Cal.) |
| Refractive index | 1.681 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glabredelphinine |