| Name | (4-Phenylphenyl) Pyrazine-2-Carboxylate |
|---|---|
| Synonyms | 2-Pyrazinecarboxylic Acid (4-Phenylphenyl) Ester; Pyrazinic Acid (4-Phenylphenyl) Ester; 4-Biphenylyl Pyrazinoate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.29 |
| CAS Registry Number | 132172-95-3 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2)OC(C3=CN=CC=N3)=O |
| InChI | 1S/C17H12N2O2/c20-17(16-12-18-10-11-19-16)21-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H |
| InChIKey | DZGWFELKBYEJSF-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.044°C at 760 mmHg (Cal.) |
| Flash point | 229.607°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (4-Phenylphenyl) Pyrazine-2-Carboxylate |