|
CAS#: 13223-03-5 Product: Methacryloyl Oxyethyl Dimethylethyl Ammonium Ethylsulfate No suppilers available for the product. |
| Name | Methacryloyl Oxyethyl Dimethylethyl Ammonium Ethylsulfate |
|---|---|
| Synonyms | Ethyl-Dimethyl-[2-(2-Methylprop-2-Enoyloxy)Ethyl]Ammonium; Ethyl Sulfate; Ethyl-Dimethyl-[2-(2-Methyl-1-Oxoprop-2-Enoxy)Ethyl]Ammonium; Ethyl Sulfate; Ethyl-(2-Methacryloyloxyethyl)-Dimethyl-Ammonium; Ethyl Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H25NO6S |
| Molecular Weight | 311.39 |
| CAS Registry Number | 13223-03-5 |
| EINECS | 236-195-6 |
| SMILES | C(O[S]([O-])(=O)=O)C.C([N+](CC)(C)C)COC(=O)C(=C)C |
| InChI | 1S/C10H20NO2.C2H6O4S/c1-6-11(4,5)7-8-13-10(12)9(2)3;1-2-6-7(3,4)5/h2,6-8H2,1,3-5H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | QUUVXPUXYIWGHA-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Methacryloyl Oxyethyl Dimethylethyl Ammonium Ethylsulfate |