|
CAS#: 132416-36-5 Product: 2,2,6,6-Tetramethyl-1-(1-Phenylethoxy)-4-Piperidinol No suppilers available for the product. |
| Name | 2,2,6,6-Tetramethyl-1-(1-Phenylethoxy)-4-Piperidinol |
|---|---|
| Synonyms | 4-hydroxy |
| Molecular Structure | ![]() |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.40 |
| CAS Registry Number | 132416-36-5 |
| SMILES | CC(ON1C(C)(C)CC(O)CC1(C)C)c2ccccc2 |
| InChI | 1S/C17H27NO2/c1-13(14-9-7-6-8-10-14)20-18-16(2,3)11-15(19)12-17(18,4)5/h6-10,13,15,19H,11-12H2,1-5H3 |
| InChIKey | APUFHRLDCFVHFO-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.735°C at 760 mmHg (Cal.) |
| Flash point | 171.967°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,6,6-Tetramethyl-1-(1-Phenylethoxy)-4-Piperidinol |