|
CAS#: 13249-75-7 Product: 1,2,4-Triphenylbut-2-Ene-1,4-Dione No suppilers available for the product. |
| Name | 1,2,4-Triphenylbut-2-Ene-1,4-Dione |
|---|---|
| Synonyms | (E)-1,2,4-Tri(Phenyl)But-2-Ene-1,4-Dione; Nsc53733; Nsc21389 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16O2 |
| Molecular Weight | 312.37 |
| CAS Registry Number | 13249-75-7 |
| SMILES | C3=C(\C(C(=O)C1=CC=CC=C1)=C/C(=O)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C22H16O2/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-16H/b20-16+ |
| InChIKey | MEBZZSFHCRISAQ-CAPFRKAQSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.986°C at 760 mmHg (Cal.) |
| Flash point | 176.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4-Triphenylbut-2-Ene-1,4-Dione |