|
CAS#: 13256-45-6 Product: Aminoglutethimide Phosphate No suppilers available for the product. |
| Name | Aminoglutethimide Phosphate |
|---|---|
| Synonyms | 3-(4-Aminophenyl)-3-Ethyl-Piperidine-2,6-Dione; Phosphoric Acid; 3-(4-Aminophenyl)-3-Ethyl-Piperidine-2,6-Quinone; Phosphoric Acid; 2,6-Piperidinedione, 3-(4-Aminophenyl)-3-Ethyl-, (+-)-, Phosphate (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19N2O6P |
| Molecular Weight | 330.28 |
| CAS Registry Number | 13256-45-6 |
| SMILES | O=[P](O)(O)O.C2=C(C1(C(=O)NC(=O)CC1)CC)C=CC(=C2)N |
| InChI | 1S/C13H16N2O2.H3O4P/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9;1-5(2,3)4/h3-6H,2,7-8,14H2,1H3,(H,15,16,17);(H3,1,2,3,4) |
| InChIKey | TXHYGJUNRXVGNI-UHFFFAOYSA-N |
| Boiling point | 457.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 230.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aminoglutethimide Phosphate |