| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | 2-(Dimethylamino)Fluorene |
|---|---|
| Synonyms | 9H-Fluoren-2-Yl-Dimethyl-Amine; 2-(Dimethylamino)Fluorene; 2-Dimethylamino-Fluoren |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 |
| CAS Registry Number | 13261-62-6 |
| SMILES | C1=C(N(C)C)C=CC2=C1CC3=C2C=CC=C3 |
| InChI | 1S/C15H15N/c1-16(2)13-7-8-15-12(10-13)9-11-5-3-4-6-14(11)15/h3-8,10H,9H2,1-2H3 |
| InChIKey | DBNDQWSTOSZFHI-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.091°C at 760 mmHg (Cal.) |
| Flash point | 149.741°C (Cal.) |
| (1) | Kwanghee Koh Park, Joon Woo Park and Andrew D. Hamilton. Novel 7-(dimethylamino)fluorene-based fluorescent probes and their binding to human serum albumin, Org. Biomol. Chem., 2009, 7, 4225. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)Fluorene |