|
CAS#: 132664-45-0 Product: 4-Chloro-8-Quinolinecarbonitrile No suppilers available for the product. |
| Name | 4-Chloro-8-Quinolinecarbonitrile |
|---|---|
| Synonyms | 4-Chloro-8-cyanoquinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5ClN2 |
| Molecular Weight | 188.61 |
| CAS Registry Number | 132664-45-0 |
| SMILES | C1=CC(=C2C(=C1)C(=CC=N2)Cl)C#N |
| InChI | 1S/C10H5ClN2/c11-9-4-5-13-10-7(6-12)2-1-3-8(9)10/h1-5H |
| InChIKey | OXKQMBHOOISBLS-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.3±22.0°C at 760 mmHg (Cal.) |
| Flash point | 159.6±22.3°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-8-Quinolinecarbonitrile |