| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Dyes and pigments >> Dyes >> Sulfur dye |
|---|---|
| Name | Vat Blue 43 |
| Synonyms | 4-(9H-Carbazol-3-Ylimino)-1-Cyclohexa-2,5-Dienone; Nsc26673; C.I. Vat Blue 43 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 |
| CAS Registry Number | 1327-79-3 |
| EINECS | 215-499-2 |
| SMILES | C1=C3C(=CC=C1N=C2C=CC(=O)C=C2)[NH]C4=CC=CC=C34 |
| InChI | 1S/C18H12N2O/c21-14-8-5-12(6-9-14)19-13-7-10-18-16(11-13)15-3-1-2-4-17(15)20-18/h1-11,20H |
| InChIKey | FMKXFJQAVQXMPX-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.643°C at 760 mmHg (Cal.) |
| Flash point | 252.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vat Blue 43 |