|
CAS#: 132766-66-6 Product: 2-Dimethylamino-1-oxa-2,3-dihydro-1H-phenalene No suppilers available for the product. |
| Name | 2-Dimethylamino-1-oxa-2,3-dihydro-1H-phenalene |
|---|---|
| Synonyms | 2-Dimethylamino-1-Oxa-2,3-Dihydro-1H-Phenalene; Naphtho(1,8-Bc)Pyran-2-Amine, 2,3-Dihydro-N,N-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 |
| CAS Registry Number | 132766-66-6 |
| SMILES | C2=CC=C1C=CC=C3C1=C2CC(O3)N(C)C |
| InChI | 1S/C14H15NO/c1-15(2)13-9-11-7-3-5-10-6-4-8-12(16-13)14(10)11/h3-8,13H,9H2,1-2H3 |
| InChIKey | CGNQKYZXRDKEPD-UHFFFAOYSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.248°C at 760 mmHg (Cal.) |
| Flash point | 105.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Dimethylamino-1-oxa-2,3-dihydro-1H-phenalene |