|
CAS#: 132899-04-8 Product: 7,9-Dihydroxy-3-Methyl-1H-Benzo[g]Isochromene-5,10-Dione No suppilers available for the product. |
| Name | 7,9-Dihydroxy-3-Methyl-1H-Benzo[g]Isochromene-5,10-Dione |
|---|---|
| Synonyms | 7,9-Dihydroxy-3-Methyl-1H-Benzo[G]Isochromene-5,10-Quinone; 1H-Naphtho(2,3-C)Pyran-5,10-Dione, 7,9-Dihydroxy-3-Methyl-; 6-Ddaf |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 |
| CAS Registry Number | 132899-04-8 |
| SMILES | C3=C(C1=C(C(C2=C(C1=O)COC(=C2)C)=O)C=C3O)O |
| InChI | 1S/C14H10O5/c1-6-2-8-10(5-19-6)14(18)12-9(13(8)17)3-7(15)4-11(12)16/h2-4,15-16H,5H2,1H3 |
| InChIKey | ATLURBSTOUCQEI-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.339°C at 760 mmHg (Cal.) |
| Flash point | 214.811°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,9-Dihydroxy-3-Methyl-1H-Benzo[g]Isochromene-5,10-Dione |